C20H26O12P2 — CID 4176877
6,21-dihydroxy-2,5,7,10,17,20,22,25-octaoxa-6λ5,21λ5-diphosphatricyclo[24.4.0.011,16]triaconta-1(30),11,13,15,26,28-hexaene 6,21-dioxide (PubChem CID 4176877) has the molecular formula C20H26O12P2 and a molecular weight of 520.36 g/mol. Its IUPAC name is 6,21-dihydroxy-2,5,7,10,17,20,22,25-octaoxa-6λ5,21λ5-diphosphatricyclo[24.4.0.011,16]triaconta-1(30),11,13,15,26,28-hexaene 6,21-dioxide.
| Compound Name | 6,21-dihydroxy-2,5,7,10,17,20,22,25-octaoxa-6λ5,21λ5-diphosphatricyclo[24.4.0.011,16]triaconta-1(30),11,13,15,26,28-hexaene 6,21-dioxide |
|---|---|
| PubChem CID | 4176877 |
| Molecular Formula | C20H26O12P2 |
| Molecular Weight | 520.36 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 6,21-dihydroxy-2,5,7,10,17,20,22,25-octaoxa-6λ5,21λ5-diphosphatricyclo[24.4.0.011,16]triaconta-1(30),11,13,15,26,28-hexaene 6,21-dioxide |
| SMILES | O=P1(O)OCCOc2ccccc2OCCOP(=O)(O)OCCOc2ccccc2OCCO1 |
| InChI | InChI=1S/C20H26O12P2/c21-33(22)29-13-9-25-17-5-1-2-6-18(17)26-10-14-30-34(23,24)32-16-12-28-20-8-4-3-7-19(20)27-11-15-31-33/h1-8H,9-16H2,(H,21,22)(H,23,24) |
| InChIKey | GPTRBFOMEQPFNJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|