C34H23N3O5S2 — CID 4177315
3-(1-benzofuran-2-carbonyl)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4177315) has the molecular formula C34H23N3O5S2 and a molecular weight of 617.71 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4177315 |
| Molecular Formula | C34H23N3O5S2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2nnc(SCc3ccccc3)s2)C1c1cccc(Oc2ccccc2)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C34H23N3O5S2/c38-30(27-19-22-12-7-8-17-26(22)42-27)28-29(23-13-9-16-25(18-23)41-24-14-5-2-6-15-24)37(32(40)31(28)39)33-35-36-34(44-33)43-20-21-10-3-1-4-11-21/h1-19,29,39H,20H2 |
| InChIKey | MUJFCCUJMRIPPP-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|