C13H14N4S2 — CID 4177514
3-(2,1,3-benzothiadiazol-5-yl)-1,1-bis(prop-2-enyl)thiourea (PubChem CID 4177514) has the molecular formula C13H14N4S2 and a molecular weight of 290.42 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-5-yl)-1,1-bis(prop-2-enyl)thiourea.
| Compound Name | 3-(2,1,3-benzothiadiazol-5-yl)-1,1-bis(prop-2-enyl)thiourea |
|---|---|
| PubChem CID | 4177514 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-5-yl)-1,1-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(CC=C)C(=S)Nc1ccc2nsnc2c1 |
| InChI | InChI=1S/C13H14N4S2/c1-3-7-17(8-4-2)13(18)14-10-5-6-11-12(9-10)16-19-15-11/h3-6,9H,1-2,7-8H2,(H,14,18) |
| InChIKey | WIVWICYGVNXNIH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|