C10H9N3O6 — CID 4177696
2-(3,4-dimethoxy-2,6-dinitrophenyl)acetonitrile (PubChem CID 4177696) has the molecular formula C10H9N3O6 and a molecular weight of 267.20 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-2,6-dinitrophenyl)acetonitrile.
| Compound Name | 2-(3,4-dimethoxy-2,6-dinitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 4177696 |
| Molecular Formula | C10H9N3O6 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-(3,4-dimethoxy-2,6-dinitrophenyl)acetonitrile |
| SMILES | COc1cc([N+](=O)[O-])c(CC#N)c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C10H9N3O6/c1-18-8-5-7(12(14)15)6(3-4-11)9(13(16)17)10(8)19-2/h5H,3H2,1-2H3 |
| InChIKey | JQIHALSAUMOCNI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 128.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|