About tricyclohexylplumbane
tricyclohexylplumbane (PubChem CID 4177825) has the molecular formula C18H34Pb
and a molecular weight of 457.67 g/mol. Its IUPAC name is tricyclohexylplumbane.
Molecular Properties
| Compound Name | tricyclohexylplumbane |
| PubChem CID | 4177825 |
| Molecular Formula | C18H34Pb |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | tricyclohexylplumbane |
| SMILES | C1CCC([PbH](C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/3C6H11.Pb.H/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;; |
| InChIKey | SCOSWXURJCHAMB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclohexylplumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexylplumbane?
The IUPAC name of tricyclohexylplumbane (CID 4177825) is tricyclohexylplumbane.
What is the SMILES notation for tricyclohexylplumbane?
The canonical SMILES for tricyclohexylplumbane is C1CCC([PbH](C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of tricyclohexylplumbane?
The InChIKey is SCOSWXURJCHAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H11.Pb.H/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;;.
What are the key properties of tricyclohexylplumbane?
tricyclohexylplumbane has a molecular weight of 457.67 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexylplumbane is sourced from PubChem (CID 4177825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).