About 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile
6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile (PubChem CID 4178652) has the molecular formula C21H17ClN2O5S
and a molecular weight of 444.90 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile |
| PubChem CID | 4178652 |
| Molecular Formula | C21H17ClN2O5S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile |
| SMILES | COc1cccc(OC)c1Oc1nc(-c2ccc(Cl)cc2)c(S(C)(=O)=O)cc1C#N |
| InChI | InChI=1S/C21H17ClN2O5S/c1-27-16-5-4-6-17(28-2)20(16)29-21-14(12-23)11-18(30(3,25)26)19(24-21)13-7-9-15(22)10-8-13/h4-11H,1-3H3 |
| InChIKey | ZMTUXQUNLUKFOI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 98.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile?
The IUPAC name of 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile (CID 4178652) is 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile.
What is the SMILES notation for 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile?
The canonical SMILES for 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile is COc1cccc(OC)c1Oc1nc(-c2ccc(Cl)cc2)c(S(C)(=O)=O)cc1C#N.
What is the InChIKey of 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile?
The InChIKey is ZMTUXQUNLUKFOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN2O5S/c1-27-16-5-4-6-17(28-2)20(16)29-21-14(12-23)11-18(30(3,25)26)19(24-21)13-7-9-15(22)10-8-13/h4-11H,1-3H3.
What are the key properties of 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile?
6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile has a molecular weight of 444.90 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-2-(2,6-dimethoxyphenoxy)-5-methylsulfonylpyridine-3-carbonitrile is sourced from PubChem (CID 4178652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).