C17H9Cl4NO4 — CID 4178669
3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid (PubChem CID 4178669) has the molecular formula C17H9Cl4NO4 and a molecular weight of 433.07 g/mol. Its IUPAC name is 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid.
| Compound Name | 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 4178669 |
| Molecular Formula | C17H9Cl4NO4 |
| Molecular Weight | 433.07 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | 3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C17H9Cl4NO4/c18-11-9-10(12(19)14(21)13(11)20)16(24)22(15(9)23)8(17(25)26)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,25,26) |
| InChIKey | SYNIXMHNTKWUFN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.07 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|