C32H23ClN6O4S2 — CID 4178748
[2-methoxy-4-[[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4178748) has the molecular formula C32H23ClN6O4S2 and a molecular weight of 655.16 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-methoxy-4-[[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4178748 |
| Molecular Formula | C32H23ClN6O4S2 |
| Molecular Weight | 655.16 g/mol |
| Exact Mass | 654.09 |
| IUPAC Name | [2-methoxy-4-[[[2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)CSc2nnc(-c3ccncc3)n2-c2ccccc2)ccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C32H23ClN6O4S2/c1-42-25-17-20(11-12-24(25)43-31(41)29-28(33)23-9-5-6-10-26(23)45-29)18-35-36-27(40)19-44-32-38-37-30(21-13-15-34-16-14-21)39(32)22-7-3-2-4-8-22/h2-18H,19H2,1H3,(H,36,40) |
| InChIKey | YMCDYQWUJMTXDF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.16 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|