C26H19ClN4O2 — CID 4179142
4-(4-chlorophenyl)-3-(4-nitrophenyl)-2,5-diphenyl-3H-1,2,4-triazole (PubChem CID 4179142) has the molecular formula C26H19ClN4O2 and a molecular weight of 454.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-(4-nitrophenyl)-2,5-diphenyl-3H-1,2,4-triazole.
| Compound Name | 4-(4-chlorophenyl)-3-(4-nitrophenyl)-2,5-diphenyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 4179142 |
| Molecular Formula | C26H19ClN4O2 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-(4-chlorophenyl)-3-(4-nitrophenyl)-2,5-diphenyl-3H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(C2N(c3ccccc3)N=C(c3ccccc3)N2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H19ClN4O2/c27-21-13-17-22(18-14-21)29-25(19-7-3-1-4-8-19)28-30(23-9-5-2-6-10-23)26(29)20-11-15-24(16-12-20)31(32)33/h1-18,26H |
| InChIKey | TWXFHGWLUBQADO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|