C14H14N3S2+ — CID 4179693
[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-phenylazanium (PubChem CID 4179693) has the molecular formula C14H14N3S2+ and a molecular weight of 288.42 g/mol. Its IUPAC name is [4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-phenylazanium.
| Compound Name | [4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-phenylazanium |
|---|---|
| PubChem CID | 4179693 |
| Molecular Formula | C14H14N3S2+ |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-phenylazanium |
| SMILES | Cc1nc(C)c(-c2csc([NH2+]c3ccccc3)n2)s1 |
| InChI | InChI=1S/C14H13N3S2/c1-9-13(19-10(2)15-9)12-8-18-14(17-12)16-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,16,17)/p+1 |
| InChIKey | NWRDDAWJDQVGFS-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 42.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|