About piperazine-2,5-dicarboxylic acid
piperazine-2,5-dicarboxylic acid (PubChem CID 4179819) has the molecular formula C6H10N2O4
and a molecular weight of 174.16 g/mol. Its IUPAC name is piperazine-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | piperazine-2,5-dicarboxylic acid |
| PubChem CID | 4179819 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | piperazine-2,5-dicarboxylic acid |
| SMILES | O=C(O)C1CNC(C(=O)O)CN1 |
| InChI | InChI=1S/C6H10N2O4/c9-5(10)3-1-7-4(2-8-3)6(11)12/h3-4,7-8H,1-2H2,(H,9,10)(H,11,12) |
| InChIKey | FBYDNPVPBDAFFV-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-2,5-dicarboxylic acid?
The IUPAC name of piperazine-2,5-dicarboxylic acid (CID 4179819) is piperazine-2,5-dicarboxylic acid.
What is the SMILES notation for piperazine-2,5-dicarboxylic acid?
The canonical SMILES for piperazine-2,5-dicarboxylic acid is O=C(O)C1CNC(C(=O)O)CN1.
What is the InChIKey of piperazine-2,5-dicarboxylic acid?
The InChIKey is FBYDNPVPBDAFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O4/c9-5(10)3-1-7-4(2-8-3)6(11)12/h3-4,7-8H,1-2H2,(H,9,10)(H,11,12).
What are the key properties of piperazine-2,5-dicarboxylic acid?
piperazine-2,5-dicarboxylic acid has a molecular weight of 174.16 g/mol, XLogP of -1.91, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-2,5-dicarboxylic acid is sourced from PubChem (CID 4179819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).