About dimethyl 3-chloropent-2-enedioate
dimethyl 3-chloropent-2-enedioate (PubChem CID 4179824) has the molecular formula C7H9ClO4
and a molecular weight of 192.60 g/mol. Its IUPAC name is dimethyl 3-chloropent-2-enedioate.
Molecular Properties
| Compound Name | dimethyl 3-chloropent-2-enedioate |
| PubChem CID | 4179824 |
| Molecular Formula | C7H9ClO4 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | dimethyl 3-chloropent-2-enedioate |
| SMILES | COC(=O)C=C(Cl)CC(=O)OC |
| InChI | InChI=1S/C7H9ClO4/c1-11-6(9)3-5(8)4-7(10)12-2/h3H,4H2,1-2H3 |
| InChIKey | QDMDYMAXAZKWQJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-chloropent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-chloropent-2-enedioate?
The IUPAC name of dimethyl 3-chloropent-2-enedioate (CID 4179824) is dimethyl 3-chloropent-2-enedioate.
What is the SMILES notation for dimethyl 3-chloropent-2-enedioate?
The canonical SMILES for dimethyl 3-chloropent-2-enedioate is COC(=O)C=C(Cl)CC(=O)OC.
What is the InChIKey of dimethyl 3-chloropent-2-enedioate?
The InChIKey is QDMDYMAXAZKWQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClO4/c1-11-6(9)3-5(8)4-7(10)12-2/h3H,4H2,1-2H3.
What are the key properties of dimethyl 3-chloropent-2-enedioate?
dimethyl 3-chloropent-2-enedioate has a molecular weight of 192.60 g/mol, XLogP of 0.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-chloropent-2-enedioate is sourced from PubChem (CID 4179824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).