bis(trimethylsilyl) hydrogen phosphate

C6H19O4PSi2 — CID 4179907

IUPACbis(trimethylsilyl) hydrogen phosphate
SMILESC[Si](C)(C)OP(=O)(O)O[Si](C)(C)C
InChIInChI=1S/C6H19O4PSi2/c1-12(2,3)9-11(7,8)10-13(4,5)6/h1-6H3,(H,7,8)
InChIKeyHVGFMUJLKBGRSF-UHFFFAOYSA-N
MW242.36 g/mol
LogP2.79
Rot. Bonds4

About bis(trimethylsilyl) hydrogen phosphate

bis(trimethylsilyl) hydrogen phosphate (PubChem CID 4179907) has the molecular formula C6H19O4PSi2 and a molecular weight of 242.36 g/mol. Its IUPAC name is bis(trimethylsilyl) hydrogen phosphate.

Molecular Properties

Compound Namebis(trimethylsilyl) hydrogen phosphate
PubChem CID4179907
Molecular FormulaC6H19O4PSi2
Molecular Weight242.36 g/mol
Exact Mass242.06
IUPAC Namebis(trimethylsilyl) hydrogen phosphate
SMILESC[Si](C)(C)OP(=O)(O)O[Si](C)(C)C
InChIInChI=1S/C6H19O4PSi2/c1-12(2,3)9-11(7,8)10-13(4,5)6/h1-6H3,(H,7,8)
InChIKeyHVGFMUJLKBGRSF-UHFFFAOYSA-N
XLogP2.79
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.36
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(trimethylsilyl) hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(trimethylsilyl) hydrogen phosphate?
The IUPAC name of bis(trimethylsilyl) hydrogen phosphate (CID 4179907) is bis(trimethylsilyl) hydrogen phosphate.
What is the SMILES notation for bis(trimethylsilyl) hydrogen phosphate?
The canonical SMILES for bis(trimethylsilyl) hydrogen phosphate is C[Si](C)(C)OP(=O)(O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) hydrogen phosphate?
The InChIKey is HVGFMUJLKBGRSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19O4PSi2/c1-12(2,3)9-11(7,8)10-13(4,5)6/h1-6H3,(H,7,8).
What are the key properties of bis(trimethylsilyl) hydrogen phosphate?
bis(trimethylsilyl) hydrogen phosphate has a molecular weight of 242.36 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) hydrogen phosphate is sourced from PubChem (CID 4179907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).