About cyclohexa-3,5-diene-1,2-diol
cyclohexa-3,5-diene-1,2-diol (PubChem CID 418) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | cyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 418 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-diol |
| SMILES | OC1C=CC=CC1O |
| InChI | InChI=1S/C6H8O2/c7-5-3-1-2-4-6(5)8/h1-8H |
| InChIKey | YDRSQRPHLBEPTP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-3,5-diene-1,2-diol?
The IUPAC name of cyclohexa-3,5-diene-1,2-diol (CID 418) is cyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for cyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for cyclohexa-3,5-diene-1,2-diol is OC1C=CC=CC1O.
What is the InChIKey of cyclohexa-3,5-diene-1,2-diol?
The InChIKey is YDRSQRPHLBEPTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c7-5-3-1-2-4-6(5)8/h1-8H.
What are the key properties of cyclohexa-3,5-diene-1,2-diol?
cyclohexa-3,5-diene-1,2-diol has a molecular weight of 112.13 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).