About 10-(methyldiazenyl)anthracene-1,4,9-triol
10-(methyldiazenyl)anthracene-1,4,9-triol (PubChem CID 4180559) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is 10-(methyldiazenyl)anthracene-1,4,9-triol.
Molecular Properties
| Compound Name | 10-(methyldiazenyl)anthracene-1,4,9-triol |
| PubChem CID | 4180559 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 10-(methyldiazenyl)anthracene-1,4,9-triol |
| SMILES | C/N=N/c1c2ccccc2c(O)c2c(O)ccc(O)c12 |
| InChI | InChI=1S/C15H12N2O3/c1-16-17-14-8-4-2-3-5-9(8)15(20)13-11(19)7-6-10(18)12(13)14/h2-7,18-20H,1H3/b17-16+ |
| InChIKey | DBUQZVUGLYNOLS-WUKNDPDISA-N |
| XLogP | 3.82 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-(methyldiazenyl)anthracene-1,4,9-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(methyldiazenyl)anthracene-1,4,9-triol?
The IUPAC name of 10-(methyldiazenyl)anthracene-1,4,9-triol (CID 4180559) is 10-(methyldiazenyl)anthracene-1,4,9-triol.
What is the SMILES notation for 10-(methyldiazenyl)anthracene-1,4,9-triol?
The canonical SMILES for 10-(methyldiazenyl)anthracene-1,4,9-triol is C/N=N/c1c2ccccc2c(O)c2c(O)ccc(O)c12.
What is the InChIKey of 10-(methyldiazenyl)anthracene-1,4,9-triol?
The InChIKey is DBUQZVUGLYNOLS-WUKNDPDISA-N. The full InChI is InChI=1S/C15H12N2O3/c1-16-17-14-8-4-2-3-5-9(8)15(20)13-11(19)7-6-10(18)12(13)14/h2-7,18-20H,1H3/b17-16+.
What are the key properties of 10-(methyldiazenyl)anthracene-1,4,9-triol?
10-(methyldiazenyl)anthracene-1,4,9-triol has a molecular weight of 268.27 g/mol, XLogP of 3.82, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(methyldiazenyl)anthracene-1,4,9-triol is sourced from PubChem (CID 4180559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).