C13H7F5N2O3S — CID 4180608
2,3,4,5,6-pentafluoro-N-(4-sulfamoylphenyl)benzamide (PubChem CID 4180608) has the molecular formula C13H7F5N2O3S and a molecular weight of 366.27 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 4180608 |
| Molecular Formula | C13H7F5N2O3S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H7F5N2O3S/c14-8-7(9(15)11(17)12(18)10(8)16)13(21)20-5-1-3-6(4-2-5)24(19,22)23/h1-4H,(H,20,21)(H2,19,22,23) |
| InChIKey | ARIFRHZMMVDEFJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|