C26H21ClN4O3 — CID 4181779
3-[3-(3-chloro-2-methylanilino)-2,3-dioxopropyl]-N-(2-methylphenyl)quinoxaline-2-carboxamide (PubChem CID 4181779) has the molecular formula C26H21ClN4O3 and a molecular weight of 472.93 g/mol. Its IUPAC name is 3-[3-(3-chloro-2-methylanilino)-2,3-dioxopropyl]-N-(2-methylphenyl)quinoxaline-2-carboxamide.
| Compound Name | 3-[3-(3-chloro-2-methylanilino)-2,3-dioxopropyl]-N-(2-methylphenyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 4181779 |
| Molecular Formula | C26H21ClN4O3 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-[3-(3-chloro-2-methylanilino)-2,3-dioxopropyl]-N-(2-methylphenyl)quinoxaline-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1nc2ccccc2nc1CC(=O)C(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C26H21ClN4O3/c1-15-8-3-4-10-18(15)30-26(34)24-22(28-20-11-5-6-12-21(20)29-24)14-23(32)25(33)31-19-13-7-9-17(27)16(19)2/h3-13H,14H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | NACNZGQYFNRZHQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|