C18H22F3N3O3 — CID 4181848
2-[5-butyl-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-2-oxo-N-(2-phenylethyl)acetamide (PubChem CID 4181848) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-[5-butyl-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-2-oxo-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[5-butyl-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-2-oxo-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4181848 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[5-butyl-3-hydroxy-3-(trifluoromethyl)-1H-pyrazol-2-yl]-2-oxo-N-(2-phenylethyl)acetamide |
| SMILES | CCCCC1=CC(O)(C(F)(F)F)N(C(=O)C(=O)NCCc2ccccc2)N1 |
| InChI | InChI=1S/C18H22F3N3O3/c1-2-3-9-14-12-17(27,18(19,20)21)24(23-14)16(26)15(25)22-11-10-13-7-5-4-6-8-13/h4-8,12,23,27H,2-3,9-11H2,1H3,(H,22,25) |
| InChIKey | CXKWQRJBHVLLPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|