C13H15N3OS — CID 4182197
2,2-dimethyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide (PubChem CID 4182197) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide.
| Compound Name | 2,2-dimethyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 4182197 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2,2-dimethyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)propanamide |
| SMILES | CC(C)(C)C(=O)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C13H15N3OS/c1-13(2,3)11(17)15-12-14-10(16-18-12)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,14,15,16,17) |
| InChIKey | TVBKSCGCXKYZFK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |