C14H15N — CID 4182798
2-phenyl-4,5,6,7-tetrahydro-1H-indole (PubChem CID 4182798) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-phenyl-4,5,6,7-tetrahydro-1H-indole.
| Compound Name | 2-phenyl-4,5,6,7-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 4182798 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-phenyl-4,5,6,7-tetrahydro-1H-indole |
| SMILES | c1ccc(-c2cc3c([nH]2)CCCC3)cc1 |
| InChI | InChI=1S/C14H15N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-3,6-7,10,15H,4-5,8-9H2 |
| InChIKey | LUAFUCCMSGFWSP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |