C11H8N2O3 — CID 4183428
2,4-dihydro-1H-chromeno[3,4-b]pyrazine-3,5-dione (PubChem CID 4183428) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 2,4-dihydro-1H-chromeno[3,4-b]pyrazine-3,5-dione.
| Compound Name | 2,4-dihydro-1H-chromeno[3,4-b]pyrazine-3,5-dione |
|---|---|
| PubChem CID | 4183428 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2,4-dihydro-1H-chromeno[3,4-b]pyrazine-3,5-dione |
| SMILES | O=C1CNc2c(c(=O)oc3ccccc23)N1 |
| InChI | InChI=1S/C11H8N2O3/c14-8-5-12-9-6-3-1-2-4-7(6)16-11(15)10(9)13-8/h1-4,12H,5H2,(H,13,14) |
| InChIKey | YAZFXSBHBYEQGE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|