C15H26O2 — CID 4183772
5,5-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane (PubChem CID 4183772) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 5,5-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane.
| Compound Name | 5,5-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 4183772 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 5,5-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane |
| SMILES | CC1=CC(C)C(C2OCC(C)(C)CO2)C(C)C1 |
| InChI | InChI=1S/C15H26O2/c1-10-6-11(2)13(12(3)7-10)14-16-8-15(4,5)9-17-14/h6,11-14H,7-9H2,1-5H3 |
| InChIKey | LBGGUVCPIQFOJE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|