C23H21N5O2 — CID 4184275
4-amino-N-benzhydryloxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 4184275) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-amino-N-benzhydryloxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N-benzhydryloxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 4184275 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-amino-N-benzhydryloxy-N'-(4-methylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1ccc(/N=C(\NOC(c2ccccc2)c2ccccc2)c2nonc2N)cc1 |
| InChI | InChI=1S/C23H21N5O2/c1-16-12-14-19(15-13-16)25-23(20-22(24)27-30-26-20)28-29-21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21H,1H3,(H2,24,27)(H,25,28) |
| InChIKey | LCIOFNAVVLCGTR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|