C23H44N4O3S — CID 4185001
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(3,5-dimethylpiperidin-1-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 4185001) has the molecular formula C23H44N4O3S and a molecular weight of 456.70 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(3,5-dimethylpiperidin-1-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(3,5-dimethylpiperidin-1-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 4185001 |
| Molecular Formula | C23H44N4O3S |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(3,5-dimethylpiperidin-1-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)C2CCCN(S(=O)(=O)N3CC(C)CC(C)C3)C2)C1 |
| InChI | InChI=1S/C23H44N4O3S/c1-18-11-19(2)14-25(13-18)9-6-8-24-23(28)22-7-5-10-26(17-22)31(29,30)27-15-20(3)12-21(4)16-27/h18-22H,5-17H2,1-4H3,(H,24,28) |
| InChIKey | ZUGGAWSIZWAEOC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|