C24H32FNO4S — CID 4185009
ethyl 5-[(4-tert-butylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]pentanoate (PubChem CID 4185009) has the molecular formula C24H32FNO4S and a molecular weight of 449.59 g/mol. Its IUPAC name is ethyl 5-[(4-tert-butylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]pentanoate.
| Compound Name | ethyl 5-[(4-tert-butylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]pentanoate |
|---|---|
| PubChem CID | 4185009 |
| Molecular Formula | C24H32FNO4S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | ethyl 5-[(4-tert-butylphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]pentanoate |
| SMILES | CCOC(=O)CCCCN(Cc1ccc(F)cc1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32FNO4S/c1-5-30-23(27)8-6-7-17-26(18-19-9-13-21(25)14-10-19)31(28,29)22-15-11-20(12-16-22)24(2,3)4/h9-16H,5-8,17-18H2,1-4H3 |
| InChIKey | FFFDXGQMTJOUHP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|