C22H18BrNO4S — CID 4185397
methyl 4-(4-bromophenyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate (PubChem CID 4185397) has the molecular formula C22H18BrNO4S and a molecular weight of 472.36 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4185397 |
| Molecular Formula | C22H18BrNO4S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[3-(4-methoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H18BrNO4S/c1-27-17-10-3-14(4-11-17)5-12-19(25)24-21-20(22(26)28-2)18(13-29-21)15-6-8-16(23)9-7-15/h3-13H,1-2H3,(H,24,25) |
| InChIKey | OXGDZEISVFGBJV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|