About 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one
2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one (PubChem CID 4185963) has the molecular formula C20H12Cl2O2
and a molecular weight of 355.22 g/mol. Its IUPAC name is 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one.
Molecular Properties
| Compound Name | 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one |
| PubChem CID | 4185963 |
| Molecular Formula | C20H12Cl2O2 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one |
| SMILES | O=C1C(=Cc2ccc(-c3cc(Cl)ccc3Cl)o2)Cc2ccccc21 |
| InChI | InChI=1S/C20H12Cl2O2/c21-14-5-7-18(22)17(11-14)19-8-6-15(24-19)10-13-9-12-3-1-2-4-16(12)20(13)23/h1-8,10-11H,9H2 |
| InChIKey | OLEUEMKUBDJOST-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one?
The IUPAC name of 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one (CID 4185963) is 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one.
What is the SMILES notation for 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one?
The canonical SMILES for 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one is O=C1C(=Cc2ccc(-c3cc(Cl)ccc3Cl)o2)Cc2ccccc21.
What is the InChIKey of 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one?
The InChIKey is OLEUEMKUBDJOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl2O2/c21-14-5-7-18(22)17(11-14)19-8-6-15(24-19)10-13-9-12-3-1-2-4-16(12)20(13)23/h1-8,10-11H,9H2.
What are the key properties of 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one?
2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one has a molecular weight of 355.22 g/mol, XLogP of 6.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3H-inden-1-one is sourced from PubChem (CID 4185963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).