C28H38N4O4 — CID 4186256
1,2-bis(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)hydrazine (PubChem CID 4186256) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1,2-bis(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)hydrazine.
| Compound Name | 1,2-bis(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)hydrazine |
|---|---|
| PubChem CID | 4186256 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 1,2-bis(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)hydrazine |
| SMILES | Cc1c(NNc2cc3c(c([N+](=O)[O-])c2C)C(C)(C)CC3(C)C)cc2c(c1[N+](=O)[O-])C(C)(C)CC2(C)C |
| InChI | InChI=1S/C28H38N4O4/c1-15-19(11-17-21(23(15)31(33)34)27(7,8)13-25(17,3)4)29-30-20-12-18-22(24(16(20)2)32(35)36)28(9,10)14-26(18,5)6/h11-12,29-30H,13-14H2,1-10H3 |
| InChIKey | GASHFJPFYIRMMP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|