2-phosphonobutanoic acid

C4H9O5P — CID 4186724

IUPAC2-phosphonobutanoic acid
SMILESCCC(C(=O)O)P(=O)(O)O
InChIInChI=1S/C4H9O5P/c1-2-3(4(5)6)10(7,8)9/h3H,2H2,1H3,(H,5,6)(H2,7,8,9)
InChIKeyPWSXRGRLZKVHLW-UHFFFAOYSA-N
MW168.08 g/mol
LogP0.03
Rot. Bonds3

About 2-phosphonobutanoic acid

2-phosphonobutanoic acid (PubChem CID 4186724) has the molecular formula C4H9O5P and a molecular weight of 168.08 g/mol. Its IUPAC name is 2-phosphonobutanoic acid.

Molecular Properties

Compound Name2-phosphonobutanoic acid
PubChem CID4186724
Molecular FormulaC4H9O5P
Molecular Weight168.08 g/mol
Exact Mass168.02
IUPAC Name2-phosphonobutanoic acid
SMILESCCC(C(=O)O)P(=O)(O)O
InChIInChI=1S/C4H9O5P/c1-2-3(4(5)6)10(7,8)9/h3H,2H2,1H3,(H,5,6)(H2,7,8,9)
InChIKeyPWSXRGRLZKVHLW-UHFFFAOYSA-N
XLogP0.03
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.08
LogP ≤ 50.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-phosphonobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phosphonobutanoic acid?
The IUPAC name of 2-phosphonobutanoic acid (CID 4186724) is 2-phosphonobutanoic acid.
What is the SMILES notation for 2-phosphonobutanoic acid?
The canonical SMILES for 2-phosphonobutanoic acid is CCC(C(=O)O)P(=O)(O)O.
What is the InChIKey of 2-phosphonobutanoic acid?
The InChIKey is PWSXRGRLZKVHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O5P/c1-2-3(4(5)6)10(7,8)9/h3H,2H2,1H3,(H,5,6)(H2,7,8,9).
What are the key properties of 2-phosphonobutanoic acid?
2-phosphonobutanoic acid has a molecular weight of 168.08 g/mol, XLogP of 0.03, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphonobutanoic acid is sourced from PubChem (CID 4186724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).