C25H31NO4 — CID 4186881
bis(prop-2-enyl) 4-(4-tert-butylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 4186881) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is bis(prop-2-enyl) 4-(4-tert-butylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 4-(4-tert-butylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4186881 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | bis(prop-2-enyl) 4-(4-tert-butylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-8-14-29-23(27)20-16(3)26-17(4)21(24(28)30-15-9-2)22(20)18-10-12-19(13-11-18)25(5,6)7/h8-13,22,26H,1-2,14-15H2,3-7H3 |
| InChIKey | NHTCYLJVQATQNT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|