About Bis(p-chlorobenzyl) ether
Bis(p-chlorobenzyl) ether (PubChem CID 41869) has the molecular formula C14H12Cl2O
and a molecular weight of 267.10 g/mol. Its IUPAC name is 1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene.
Molecular Properties
| Compound Name | Bis(p-chlorobenzyl) ether |
| PubChem CID | 41869 |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.10 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene |
| SMILES | C1=CC(=CC=C1COCC2=CC=C(C=C2)Cl)Cl |
| InChI | InChI=1S/C14H12Cl2O/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8H,9-10H2 |
| InChIKey | REXQTRHCVRPOMB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | 184 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.10 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Bis(p-chlorobenzyl) ether with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bis(p-chlorobenzyl) ether?
The IUPAC name of Bis(p-chlorobenzyl) ether (CID 41869) is 1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene.
What is the SMILES notation for Bis(p-chlorobenzyl) ether?
The canonical SMILES for Bis(p-chlorobenzyl) ether is C1=CC(=CC=C1COCC2=CC=C(C=C2)Cl)Cl.
What is the InChIKey of Bis(p-chlorobenzyl) ether?
The InChIKey is REXQTRHCVRPOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2O/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8H,9-10H2.
What are the key properties of Bis(p-chlorobenzyl) ether?
Bis(p-chlorobenzyl) ether has a molecular weight of 267.10 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Bis(p-chlorobenzyl) ether is sourced from PubChem (CID 41869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).