C21H8F22N2O2 — CID 4187067
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide (PubChem CID 4187067) has the molecular formula C21H8F22N2O2 and a molecular weight of 738.26 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4187067 |
| Molecular Formula | C21H8F22N2O2 |
| Molecular Weight | 738.26 g/mol |
| Exact Mass | 738.02 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c(NC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c1 |
| InChI | InChI=1S/C21H8F22N2O2/c1-5-2-3-6(44-8(46)10(22)12(24,25)16(32,33)20(40,41)17(34,35)13(10,26)27)7(4-5)45-9(47)11(23)14(28,29)18(36,37)21(42,43)19(38,39)15(11,30)31/h2-4H,1H3,(H,44,46)(H,45,47) |
| InChIKey | ISLPVIFQDKZFLD-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.26 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|