About N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide (PubChem CID 4187615) has the molecular formula C18H15ClN2O3S2
and a molecular weight of 406.92 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide.
Molecular Properties
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide |
| PubChem CID | 4187615 |
| Molecular Formula | C18H15ClN2O3S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide |
| SMILES | N#Cc1ccccc1Sc1ccccc1C(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C18H15ClN2O3S2/c19-14-10-26(23,24)11-15(14)21-18(22)13-6-2-4-8-17(13)25-16-7-3-1-5-12(16)9-20/h1-8,14-15H,10-11H2,(H,21,22) |
| InChIKey | MQPVWVQAQHPUBN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide?
The IUPAC name of N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide (CID 4187615) is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide.
What is the SMILES notation for N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide?
The canonical SMILES for N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide is N#Cc1ccccc1Sc1ccccc1C(=O)NC1CS(=O)(=O)CC1Cl.
What is the InChIKey of N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide?
The InChIKey is MQPVWVQAQHPUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O3S2/c19-14-10-26(23,24)11-15(14)21-18(22)13-6-2-4-8-17(13)25-16-7-3-1-5-12(16)9-20/h1-8,14-15H,10-11H2,(H,21,22).
What are the key properties of N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide?
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide has a molecular weight of 406.92 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(2-cyanophenyl)sulfanylbenzamide is sourced from PubChem (CID 4187615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).