C34H51NO4 — CID 4187736
cyclohexyl-[5,13-dihydroxy-5-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4187736) has the molecular formula C34H51NO4 and a molecular weight of 537.79 g/mol. Its IUPAC name is cyclohexyl-[5,13-dihydroxy-5-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5,13-dihydroxy-5-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4187736 |
| Molecular Formula | C34H51NO4 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | cyclohexyl-[5,13-dihydroxy-5-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCC1CO |
| InChI | InChI=1S/C34H51NO4/c1-30-13-10-25(37)19-32(30)16-17-34(26(20-32)29(38)23-7-4-3-5-8-23)27(30)11-14-31(2)28(34)12-15-33(31,39)22-35-18-6-9-24(35)21-36/h16-17,20,23-25,27-28,36-37,39H,3-15,18-19,21-22H2,1-2H3 |
| InChIKey | WLRIGLXNJCQATC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|