About 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one
3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one (PubChem CID 4188218) has the molecular formula C15H16N3O5+
and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one.
Molecular Properties
| Compound Name | 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one |
| PubChem CID | 4188218 |
| Molecular Formula | C15H16N3O5+ |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one |
| SMILES | O=C1C=CC2([N+](=O)[O-])C[NH+](Cc3ccccc3)CC1([N+](=O)[O-])C2 |
| InChI | InChI=1S/C15H15N3O5/c19-13-6-7-14(17(20)21)9-15(13,18(22)23)11-16(10-14)8-12-4-2-1-3-5-12/h1-7H,8-11H2/p+1 |
| InChIKey | CDMIBGNPCQFODQ-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one?
The IUPAC name of 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one (CID 4188218) is 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one.
What is the SMILES notation for 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one?
The canonical SMILES for 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one is O=C1C=CC2([N+](=O)[O-])C[NH+](Cc3ccccc3)CC1([N+](=O)[O-])C2.
What is the InChIKey of 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one?
The InChIKey is CDMIBGNPCQFODQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H15N3O5/c19-13-6-7-14(17(20)21)9-15(13,18(22)23)11-16(10-14)8-12-4-2-1-3-5-12/h1-7H,8-11H2/p+1.
What are the key properties of 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one?
3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one has a molecular weight of 318.31 g/mol, XLogP of -0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]non-7-en-6-one is sourced from PubChem (CID 4188218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).