About N-butan-2-ylnonanamide
N-butan-2-ylnonanamide (PubChem CID 4188803) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is N-butan-2-ylnonanamide.
Molecular Properties
| Compound Name | N-butan-2-ylnonanamide |
| PubChem CID | 4188803 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-butan-2-ylnonanamide |
| SMILES | CCCCCCCCC(=O)NC(C)CC |
| InChI | InChI=1S/C13H27NO/c1-4-6-7-8-9-10-11-13(15)14-12(3)5-2/h12H,4-11H2,1-3H3,(H,14,15) |
| InChIKey | FLQUXICPKRDSNW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylnonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylnonanamide?
The IUPAC name of N-butan-2-ylnonanamide (CID 4188803) is N-butan-2-ylnonanamide.
What is the SMILES notation for N-butan-2-ylnonanamide?
The canonical SMILES for N-butan-2-ylnonanamide is CCCCCCCCC(=O)NC(C)CC.
What is the InChIKey of N-butan-2-ylnonanamide?
The InChIKey is FLQUXICPKRDSNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-4-6-7-8-9-10-11-13(15)14-12(3)5-2/h12H,4-11H2,1-3H3,(H,14,15).
What are the key properties of N-butan-2-ylnonanamide?
N-butan-2-ylnonanamide has a molecular weight of 213.36 g/mol, XLogP of 3.65, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylnonanamide is sourced from PubChem (CID 4188803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).