C19H21N3O2 — CID 4189502
3,3,6,7-tetramethyl-N-(4-nitrophenyl)-4H-isoquinolin-1-amine (PubChem CID 4189502) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3,3,6,7-tetramethyl-N-(4-nitrophenyl)-4H-isoquinolin-1-amine.
| Compound Name | 3,3,6,7-tetramethyl-N-(4-nitrophenyl)-4H-isoquinolin-1-amine |
|---|---|
| PubChem CID | 4189502 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3,3,6,7-tetramethyl-N-(4-nitrophenyl)-4H-isoquinolin-1-amine |
| SMILES | Cc1cc2c(cc1C)C(Nc1ccc([N+](=O)[O-])cc1)=NC(C)(C)C2 |
| InChI | InChI=1S/C19H21N3O2/c1-12-9-14-11-19(3,4)21-18(17(14)10-13(12)2)20-15-5-7-16(8-6-15)22(23)24/h5-10H,11H2,1-4H3,(H,20,21) |
| InChIKey | YCELTSYTAHNUAJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|