C20H31N3O4S — CID 4189691
ethyl 2-[[(3-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]acetate (PubChem CID 4189691) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is ethyl 2-[[(3-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]acetate.
| Compound Name | ethyl 2-[[(3-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]acetate |
|---|---|
| PubChem CID | 4189691 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 2-[[(3-methoxyphenyl)methyl-(3-morpholin-4-ylpropyl)carbamothioyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=S)N(CCCN1CCOCC1)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C20H31N3O4S/c1-3-27-19(24)15-21-20(28)23(9-5-8-22-10-12-26-13-11-22)16-17-6-4-7-18(14-17)25-2/h4,6-7,14H,3,5,8-13,15-16H2,1-2H3,(H,21,28) |
| InChIKey | ANICMKAIPSDMGM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|