C18H19N3O4S — CID 4190072
2-[(2-methyl-3-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 4190072) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[(2-methyl-3-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(2-methyl-3-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4190072 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[(2-methyl-3-nitrobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2sc3c(c2C(N)=O)CCCCC3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O4S/c1-10-11(7-5-8-13(10)21(24)25)17(23)20-18-15(16(19)22)12-6-3-2-4-9-14(12)26-18/h5,7-8H,2-4,6,9H2,1H3,(H2,19,22)(H,20,23) |
| InChIKey | NEKYIFAGZRRXEH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|