About 4-(furan-2-yl)aniline
4-(furan-2-yl)aniline (PubChem CID 4191105) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-(furan-2-yl)aniline.
Molecular Properties
| Compound Name | 4-(furan-2-yl)aniline |
| PubChem CID | 4191105 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 4-(furan-2-yl)aniline |
| SMILES | Nc1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C10H9NO/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H,11H2 |
| InChIKey | QSKZDXHSTLCYPB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(furan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)aniline?
The IUPAC name of 4-(furan-2-yl)aniline (CID 4191105) is 4-(furan-2-yl)aniline.
What is the SMILES notation for 4-(furan-2-yl)aniline?
The canonical SMILES for 4-(furan-2-yl)aniline is Nc1ccc(-c2ccco2)cc1.
What is the InChIKey of 4-(furan-2-yl)aniline?
The InChIKey is QSKZDXHSTLCYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H,11H2.
What are the key properties of 4-(furan-2-yl)aniline?
4-(furan-2-yl)aniline has a molecular weight of 159.19 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)aniline is sourced from PubChem (CID 4191105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).