About N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide
N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide (PubChem CID 4192512) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide |
| PubChem CID | 4192512 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide |
| SMILES | C=CC(=O)NC(O)C(OC)OC |
| InChI | InChI=1S/C7H13NO4/c1-4-5(9)8-6(10)7(11-2)12-3/h4,6-7,10H,1H2,2-3H3,(H,8,9) |
| InChIKey | XWQDTJROXGIDKW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide?
The IUPAC name of N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide (CID 4192512) is N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide.
What is the SMILES notation for N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide?
The canonical SMILES for N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide is C=CC(=O)NC(O)C(OC)OC.
What is the InChIKey of N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide?
The InChIKey is XWQDTJROXGIDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-4-5(9)8-6(10)7(11-2)12-3/h4,6-7,10H,1H2,2-3H3,(H,8,9).
What are the key properties of N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide?
N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide has a molecular weight of 175.18 g/mol, XLogP of -0.77, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-2,2-dimethoxyethyl)prop-2-enamide is sourced from PubChem (CID 4192512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).