C40H61NO5S — CID 4193632
N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]methanesulfonamide (PubChem CID 4193632) has the molecular formula C40H61NO5S and a molecular weight of 668.00 g/mol. Its IUPAC name is N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]methanesulfonamide.
| Compound Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 4193632 |
| Molecular Formula | C40H61NO5S |
| Molecular Weight | 668.00 g/mol |
| Exact Mass | 667.43 |
| IUPAC Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]methanesulfonamide |
| SMILES | CC1(C)C2CCC(CN(CC3(O)CCC4C56C=CC7(C=C5C(=O)C5CCCCC5)CC(O)CCC7(C)C6CCC43C)S(C)(=O)=O)C1C2 |
| InChI | InChI=1S/C40H61NO5S/c1-35(2)28-12-11-27(30(35)21-28)24-41(47(5,45)46)25-39(44)18-15-33-37(39,4)17-14-32-36(3)16-13-29(42)22-38(36)19-20-40(32,33)31(23-38)34(43)26-9-7-6-8-10-26/h19-20,23,26-30,32-33,42,44H,6-18,21-22,24-25H2,1-5H3 |
| InChIKey | DWDWEQFILBNMOY-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.00 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|