C14H9ClF8N4O3 — CID 4193987
N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 4193987) has the molecular formula C14H9ClF8N4O3 and a molecular weight of 468.69 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4193987 |
| Molecular Formula | C14H9ClF8N4O3 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)COc1nc(Nc2ccc(OC(F)(F)Cl)cc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H9ClF8N4O3/c15-14(22,23)30-8-3-1-7(2-4-8)24-9-25-10(28-5-12(16,17)18)27-11(26-9)29-6-13(19,20)21/h1-4H,5-6H2,(H,24,25,26,27) |
| InChIKey | ZUECKJVSRWKPTI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|