About 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one
2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 4194181) has the molecular formula C17H14BrNO4S
and a molecular weight of 408.27 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 4194181 |
| Molecular Formula | C17H14BrNO4S |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)CSC2c2cc3c(cc2Br)OCO3)cc1 |
| InChI | InChI=1S/C17H14BrNO4S/c1-21-11-4-2-10(3-5-11)19-16(20)8-24-17(19)12-6-14-15(7-13(12)18)23-9-22-14/h2-7,17H,8-9H2,1H3 |
| InChIKey | FNZJRUYPLCRFDE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one (CID 4194181) is 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one is COc1ccc(N2C(=O)CSC2c2cc3c(cc2Br)OCO3)cc1.
What is the InChIKey of 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one?
The InChIKey is FNZJRUYPLCRFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO4S/c1-21-11-4-2-10(3-5-11)19-16(20)8-24-17(19)12-6-14-15(7-13(12)18)23-9-22-14/h2-7,17H,8-9H2,1H3.
What are the key properties of 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one?
2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one has a molecular weight of 408.27 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 4194181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).