C17H18N6O4 — CID 4194427
1-[7-(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)heptyl]-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 4194427) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[7-(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)heptyl]-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-[7-(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)heptyl]-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 4194427 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[7-(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)heptyl]-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(CCCCCCCc2[nH]c(=O)[nH]c(=O)c2C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N6O4/c18-8-11-10-23(17(27)22-14(11)24)7-5-3-1-2-4-6-13-12(9-19)15(25)21-16(26)20-13/h10H,1-7H2,(H,22,24,27)(H2,20,21,25,26) |
| InChIKey | CYIIEBDRIAXBCJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 168.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|