C23H19N3O2S2 — CID 4194545
3-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 4194545) has the molecular formula C23H19N3O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 3-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4194545 |
| Molecular Formula | C23H19N3O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 3-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C(c1ccc(Cn2c(=S)[nH]c3ccsc3c2=O)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H19N3O2S2/c27-21(25-11-9-16-3-1-2-4-18(16)14-25)17-7-5-15(6-8-17)13-26-22(28)20-19(10-12-30-20)24-23(26)29/h1-8,10,12H,9,11,13-14H2,(H,24,29) |
| InChIKey | AZMJRCBRZVUNDK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|