About N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide
N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide (PubChem CID 4194613) has the molecular formula C22H30N2O4
and a molecular weight of 386.49 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide |
| PubChem CID | 4194613 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide |
| SMILES | COCCCN(CCC(=O)NCCc1ccccc1)C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C22H30N2O4/c1-17-16-20(18(2)28-17)22(26)24(13-7-15-27-3)14-11-21(25)23-12-10-19-8-5-4-6-9-19/h4-6,8-9,16H,7,10-15H2,1-3H3,(H,23,25) |
| InChIKey | ROQBAPWVTYJNOV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide?
The IUPAC name of N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide (CID 4194613) is N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide.
What is the SMILES notation for N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide?
The canonical SMILES for N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide is COCCCN(CCC(=O)NCCc1ccccc1)C(=O)c1cc(C)oc1C.
What is the InChIKey of N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide?
The InChIKey is ROQBAPWVTYJNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O4/c1-17-16-20(18(2)28-17)22(26)24(13-7-15-27-3)14-11-21(25)23-12-10-19-8-5-4-6-9-19/h4-6,8-9,16H,7,10-15H2,1-3H3,(H,23,25).
What are the key properties of N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide?
N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide has a molecular weight of 386.49 g/mol, XLogP of 3.12, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2,5-dimethyl-N-[3-oxo-3-(2-phenylethylamino)propyl]furan-3-carboxamide is sourced from PubChem (CID 4194613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).