About phenyl-(2,3,5,6-tetramethylphenyl)methanone
phenyl-(2,3,5,6-tetramethylphenyl)methanone (PubChem CID 4195306) has the molecular formula C17H18O
and a molecular weight of 238.33 g/mol. Its IUPAC name is phenyl-(2,3,5,6-tetramethylphenyl)methanone.
Molecular Properties
| Compound Name | phenyl-(2,3,5,6-tetramethylphenyl)methanone |
| PubChem CID | 4195306 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | phenyl-(2,3,5,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C)c(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C17H18O/c1-11-10-12(2)14(4)16(13(11)3)17(18)15-8-6-5-7-9-15/h5-10H,1-4H3 |
| InChIKey | SYWIOWXMHAQPTK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenyl-(2,3,5,6-tetramethylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(2,3,5,6-tetramethylphenyl)methanone?
The IUPAC name of phenyl-(2,3,5,6-tetramethylphenyl)methanone (CID 4195306) is phenyl-(2,3,5,6-tetramethylphenyl)methanone.
What is the SMILES notation for phenyl-(2,3,5,6-tetramethylphenyl)methanone?
The canonical SMILES for phenyl-(2,3,5,6-tetramethylphenyl)methanone is Cc1cc(C)c(C)c(C(=O)c2ccccc2)c1C.
What is the InChIKey of phenyl-(2,3,5,6-tetramethylphenyl)methanone?
The InChIKey is SYWIOWXMHAQPTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O/c1-11-10-12(2)14(4)16(13(11)3)17(18)15-8-6-5-7-9-15/h5-10H,1-4H3.
What are the key properties of phenyl-(2,3,5,6-tetramethylphenyl)methanone?
phenyl-(2,3,5,6-tetramethylphenyl)methanone has a molecular weight of 238.33 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(2,3,5,6-tetramethylphenyl)methanone is sourced from PubChem (CID 4195306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).