C20H18NO4S- — CID 4195328
5-[2-(4-ethoxyanilino)-2-oxoethyl]naphthalene-1-sulfinate (PubChem CID 4195328) has the molecular formula C20H18NO4S- and a molecular weight of 368.43 g/mol. Its IUPAC name is 5-[2-(4-ethoxyanilino)-2-oxoethyl]naphthalene-1-sulfinate.
| Compound Name | 5-[2-(4-ethoxyanilino)-2-oxoethyl]naphthalene-1-sulfinate |
|---|---|
| PubChem CID | 4195328 |
| Molecular Formula | C20H18NO4S- |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-[2-(4-ethoxyanilino)-2-oxoethyl]naphthalene-1-sulfinate |
| SMILES | CCOc1ccc(NC(=O)Cc2cccc3c(S(=O)[O-])cccc23)cc1 |
| InChI | InChI=1S/C20H19NO4S/c1-2-25-16-11-9-15(10-12-16)21-20(22)13-14-5-3-7-18-17(14)6-4-8-19(18)26(23)24/h3-12H,2,13H2,1H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | TZYGSQWJEPOJDM-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|