C17H18F3N5O5S — CID 4195607
ethyl 2-acetamido-3,3,3-trifluoro-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]propanoate (PubChem CID 4195607) has the molecular formula C17H18F3N5O5S and a molecular weight of 461.42 g/mol. Its IUPAC name is ethyl 2-acetamido-3,3,3-trifluoro-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]propanoate.
| Compound Name | ethyl 2-acetamido-3,3,3-trifluoro-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]propanoate |
|---|---|
| PubChem CID | 4195607 |
| Molecular Formula | C17H18F3N5O5S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | ethyl 2-acetamido-3,3,3-trifluoro-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]propanoate |
| SMILES | CCOC(=O)C(NC(C)=O)(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3N5O5S/c1-3-30-14(27)16(17(18,19)20,23-11(2)26)24-12-5-7-13(8-6-12)31(28,29)25-15-21-9-4-10-22-15/h4-10,24H,3H2,1-2H3,(H,23,26)(H,21,22,25) |
| InChIKey | FTDLVWIMFRSWIY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|